About N-(1,5-dimethylpyrazol-4-yl)-2-pyridin-4-yl-1,3-thiazole-5-carboxamide
N-(1,5-dimethylpyrazol-4-yl)-2-pyridin-4-yl-1,3-thiazole-5-carboxamide (PubChem CID 166217040) has the molecular formula C14H13N5OS
and a molecular weight of 299.36 g/mol. Its IUPAC name is N-(1,5-dimethylpyrazol-4-yl)-2-pyridin-4-yl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(1,5-dimethylpyrazol-4-yl)-2-pyridin-4-yl-1,3-thiazole-5-carboxamide |
| PubChem CID | 166217040 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N-(1,5-dimethylpyrazol-4-yl)-2-pyridin-4-yl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1c(NC(=O)c2cnc(-c3ccncc3)s2)cnn1C |
| InChI | InChI=1S/C14H13N5OS/c1-9-11(7-17-19(9)2)18-13(20)12-8-16-14(21-12)10-3-5-15-6-4-10/h3-8H,1-2H3,(H,18,20) |
| InChIKey | BUHSPLRXLHELPM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(1,5-dimethylpyrazol-4-yl)-2-pyridin-4-yl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,5-dimethylpyrazol-4-yl)-2-pyridin-4-yl-1,3-thiazole-5-carboxamide?
The IUPAC name of N-(1,5-dimethylpyrazol-4-yl)-2-pyridin-4-yl-1,3-thiazole-5-carboxamide (CID 166217040) is N-(1,5-dimethylpyrazol-4-yl)-2-pyridin-4-yl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-(1,5-dimethylpyrazol-4-yl)-2-pyridin-4-yl-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-(1,5-dimethylpyrazol-4-yl)-2-pyridin-4-yl-1,3-thiazole-5-carboxamide is Cc1c(NC(=O)c2cnc(-c3ccncc3)s2)cnn1C.
What is the InChIKey of N-(1,5-dimethylpyrazol-4-yl)-2-pyridin-4-yl-1,3-thiazole-5-carboxamide?
The InChIKey is BUHSPLRXLHELPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N5OS/c1-9-11(7-17-19(9)2)18-13(20)12-8-16-14(21-12)10-3-5-15-6-4-10/h3-8H,1-2H3,(H,18,20).
What are the key properties of N-(1,5-dimethylpyrazol-4-yl)-2-pyridin-4-yl-1,3-thiazole-5-carboxamide?
N-(1,5-dimethylpyrazol-4-yl)-2-pyridin-4-yl-1,3-thiazole-5-carboxamide has a molecular weight of 299.36 g/mol, XLogP of 2.50, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,5-dimethylpyrazol-4-yl)-2-pyridin-4-yl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 166217040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).