C21H25N3O2 — CID 166217162
1-(2,2-dicyclopropylethyl)-3-[(2-phenoxy-4-pyridinyl)methyl]urea (PubChem CID 166217162) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-(2,2-dicyclopropylethyl)-3-[(2-phenoxy-4-pyridinyl)methyl]urea.
| Compound Name | 1-(2,2-dicyclopropylethyl)-3-[(2-phenoxy-4-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 166217162 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 1-(2,2-dicyclopropylethyl)-3-[(2-phenoxy-4-pyridinyl)methyl]urea |
| SMILES | O=C(NCc1ccnc(Oc2ccccc2)c1)NCC(C1CC1)C1CC1 |
| InChI | InChI=1S/C21H25N3O2/c25-21(24-14-19(16-6-7-16)17-8-9-17)23-13-15-10-11-22-20(12-15)26-18-4-2-1-3-5-18/h1-5,10-12,16-17,19H,6-9,13-14H2,(H2,23,24,25) |
| InChIKey | UMXRLJLKYFJAMO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |