C21H20N2O4S2 — CID 166217956
5-(benzenesulfonyl)-N-(2-morpholin-4-ylphenyl)thiophene-2-carboxamide (PubChem CID 166217956) has the molecular formula C21H20N2O4S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-N-(2-morpholin-4-ylphenyl)thiophene-2-carboxamide.
| Compound Name | 5-(benzenesulfonyl)-N-(2-morpholin-4-ylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 166217956 |
| Molecular Formula | C21H20N2O4S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 5-(benzenesulfonyl)-N-(2-morpholin-4-ylphenyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCOCC1)c1ccc(S(=O)(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C21H20N2O4S2/c24-21(22-17-8-4-5-9-18(17)23-12-14-27-15-13-23)19-10-11-20(28-19)29(25,26)16-6-2-1-3-7-16/h1-11H,12-15H2,(H,22,24) |
| InChIKey | CGULIYOCMVHVJY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |