C22H22N8O2 — CID 166218424
N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)-phenylmethyl]-N-[1-(pyridin-2-ylmethyl)pyrazol-3-yl]oxamide (PubChem CID 166218424) has the molecular formula C22H22N8O2 and a molecular weight of 430.47 g/mol. Its IUPAC name is N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)-phenylmethyl]-N-[1-(pyridin-2-ylmethyl)pyrazol-3-yl]oxamide.
| Compound Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)-phenylmethyl]-N-[1-(pyridin-2-ylmethyl)pyrazol-3-yl]oxamide |
|---|---|
| PubChem CID | 166218424 |
| Molecular Formula | C22H22N8O2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)-phenylmethyl]-N-[1-(pyridin-2-ylmethyl)pyrazol-3-yl]oxamide |
| SMILES | Cc1nnc(C(NC(=O)C(=O)Nc2ccn(Cc3ccccn3)n2)c2ccccc2)n1C |
| InChI | InChI=1S/C22H22N8O2/c1-15-26-27-20(29(15)2)19(16-8-4-3-5-9-16)25-22(32)21(31)24-18-11-13-30(28-18)14-17-10-6-7-12-23-17/h3-13,19H,14H2,1-2H3,(H,25,32)(H,24,28,31) |
| InChIKey | CYYSYASQWOCEMI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|