C22H16N6OS — CID 166218458
5-(3-methyl-4-pyridinyl)-N-(1-quinoxalin-2-ylpyrazol-4-yl)thiophene-2-carboxamide (PubChem CID 166218458) has the molecular formula C22H16N6OS and a molecular weight of 412.48 g/mol. Its IUPAC name is 5-(3-methyl-4-pyridinyl)-N-(1-quinoxalin-2-ylpyrazol-4-yl)thiophene-2-carboxamide.
| Compound Name | 5-(3-methyl-4-pyridinyl)-N-(1-quinoxalin-2-ylpyrazol-4-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 166218458 |
| Molecular Formula | C22H16N6OS |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 5-(3-methyl-4-pyridinyl)-N-(1-quinoxalin-2-ylpyrazol-4-yl)thiophene-2-carboxamide |
| SMILES | Cc1cnccc1-c1ccc(C(=O)Nc2cnn(-c3cnc4ccccc4n3)c2)s1 |
| InChI | InChI=1S/C22H16N6OS/c1-14-10-23-9-8-16(14)19-6-7-20(30-19)22(29)26-15-11-25-28(13-15)21-12-24-17-4-2-3-5-18(17)27-21/h2-13H,1H3,(H,26,29) |
| InChIKey | UGPCEVMMUOZPEI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |