C11H9F3N4O2 — CID 166219541
2,3,4-trifluoro-N-[1-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)ethyl]benzamide (PubChem CID 166219541) has the molecular formula C11H9F3N4O2 and a molecular weight of 286.21 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[1-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)ethyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[1-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 166219541 |
| Molecular Formula | C11H9F3N4O2 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2,3,4-trifluoro-N-[1-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(F)c(F)c1F)c1n[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C11H9F3N4O2/c1-4(9-16-11(20)18-17-9)15-10(19)5-2-3-6(12)8(14)7(5)13/h2-4H,1H3,(H,15,19)(H2,16,17,18,20) |
| InChIKey | YPPMVGLPPFKPOT-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|