C20H24N6O4 — CID 166219715
1-N,4-N-bis[1-(5-methyl-1,2,4-oxadiazol-3-yl)propyl]benzene-1,4-dicarboxamide (PubChem CID 166219715) has the molecular formula C20H24N6O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is 1-N,4-N-bis[1-(5-methyl-1,2,4-oxadiazol-3-yl)propyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[1-(5-methyl-1,2,4-oxadiazol-3-yl)propyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 166219715 |
| Molecular Formula | C20H24N6O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 1-N,4-N-bis[1-(5-methyl-1,2,4-oxadiazol-3-yl)propyl]benzene-1,4-dicarboxamide |
| SMILES | CCC(NC(=O)c1ccc(C(=O)NC(CC)c2noc(C)n2)cc1)c1noc(C)n1 |
| InChI | InChI=1S/C20H24N6O4/c1-5-15(17-21-11(3)29-25-17)23-19(27)13-7-9-14(10-8-13)20(28)24-16(6-2)18-22-12(4)30-26-18/h7-10,15-16H,5-6H2,1-4H3,(H,23,27)(H,24,28) |
| InChIKey | OSSUNRGEMYJCCS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |