C17H18N2O3 — CID 166219985
4-[(E)-3-(1-benzofuran-2-yl)prop-2-enoyl]-3-methyl-1,4-diazepan-2-one (PubChem CID 166219985) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 4-[(E)-3-(1-benzofuran-2-yl)prop-2-enoyl]-3-methyl-1,4-diazepan-2-one.
| Compound Name | 4-[(E)-3-(1-benzofuran-2-yl)prop-2-enoyl]-3-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 166219985 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 4-[(E)-3-(1-benzofuran-2-yl)prop-2-enoyl]-3-methyl-1,4-diazepan-2-one |
| SMILES | CC1C(=O)NCCCN1C(=O)/C=C/c1cc2ccccc2o1 |
| InChI | InChI=1S/C17H18N2O3/c1-12-17(21)18-9-4-10-19(12)16(20)8-7-14-11-13-5-2-3-6-15(13)22-14/h2-3,5-8,11-12H,4,9-10H2,1H3,(H,18,21)/b8-7+ |
| InChIKey | AIGCSAYSWQKQQQ-BQYQJAHWSA-N |
| XLogP | 2.18 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|