About 2-(trifluoromethylsulfanyl)ethyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate
2-(trifluoromethylsulfanyl)ethyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate (PubChem CID 166220428) has the molecular formula C11H12F3NO3S2
and a molecular weight of 327.35 g/mol. Its IUPAC name is 2-(trifluoromethylsulfanyl)ethyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | 2-(trifluoromethylsulfanyl)ethyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate |
| PubChem CID | 166220428 |
| Molecular Formula | C11H12F3NO3S2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 2-(trifluoromethylsulfanyl)ethyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate |
| SMILES | O=C(OCCSC(F)(F)F)c1cnc(C2CCCO2)s1 |
| InChI | InChI=1S/C11H12F3NO3S2/c12-11(13,14)19-5-4-18-10(16)8-6-15-9(20-8)7-2-1-3-17-7/h6-7H,1-5H2 |
| InChIKey | NWLKMSVCUHDHTM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(trifluoromethylsulfanyl)ethyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trifluoromethylsulfanyl)ethyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate?
The IUPAC name of 2-(trifluoromethylsulfanyl)ethyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate (CID 166220428) is 2-(trifluoromethylsulfanyl)ethyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate.
What is the SMILES notation for 2-(trifluoromethylsulfanyl)ethyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate?
The canonical SMILES for 2-(trifluoromethylsulfanyl)ethyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate is O=C(OCCSC(F)(F)F)c1cnc(C2CCCO2)s1.
What is the InChIKey of 2-(trifluoromethylsulfanyl)ethyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate?
The InChIKey is NWLKMSVCUHDHTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3NO3S2/c12-11(13,14)19-5-4-18-10(16)8-6-15-9(20-8)7-2-1-3-17-7/h6-7H,1-5H2.
What are the key properties of 2-(trifluoromethylsulfanyl)ethyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate?
2-(trifluoromethylsulfanyl)ethyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate has a molecular weight of 327.35 g/mol, XLogP of 3.40, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trifluoromethylsulfanyl)ethyl 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 166220428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).