C22H36N4O4 — CID 166220958
3-[1-[1-[3-(3-amino-3-oxopropyl)piperidine-1-carbonyl]cyclobutanecarbonyl]piperidin-3-yl]propanamide (PubChem CID 166220958) has the molecular formula C22H36N4O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is 3-[1-[1-[3-(3-amino-3-oxopropyl)piperidine-1-carbonyl]cyclobutanecarbonyl]piperidin-3-yl]propanamide.
| Compound Name | 3-[1-[1-[3-(3-amino-3-oxopropyl)piperidine-1-carbonyl]cyclobutanecarbonyl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 166220958 |
| Molecular Formula | C22H36N4O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | 3-[1-[1-[3-(3-amino-3-oxopropyl)piperidine-1-carbonyl]cyclobutanecarbonyl]piperidin-3-yl]propanamide |
| SMILES | NC(=O)CCC1CCCN(C(=O)C2(C(=O)N3CCCC(CCC(N)=O)C3)CCC2)C1 |
| InChI | InChI=1S/C22H36N4O4/c23-18(27)8-6-16-4-1-12-25(14-16)20(29)22(10-3-11-22)21(30)26-13-2-5-17(15-26)7-9-19(24)28/h16-17H,1-15H2,(H2,23,27)(H2,24,28) |
| InChIKey | NDLHOTVIFHLPFA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|