About 2-(2-methoxyanilino)-5,6-dihydro-4H-1,3-benzothiazol-7-one
2-(2-methoxyanilino)-5,6-dihydro-4H-1,3-benzothiazol-7-one (PubChem CID 166222120) has the molecular formula C14H14N2O2S
and a molecular weight of 274.35 g/mol. Its IUPAC name is 2-(2-methoxyanilino)-5,6-dihydro-4H-1,3-benzothiazol-7-one.
Molecular Properties
| Compound Name | 2-(2-methoxyanilino)-5,6-dihydro-4H-1,3-benzothiazol-7-one |
| PubChem CID | 166222120 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-(2-methoxyanilino)-5,6-dihydro-4H-1,3-benzothiazol-7-one |
| SMILES | COc1ccccc1Nc1nc2c(s1)C(=O)CCC2 |
| InChI | InChI=1S/C14H14N2O2S/c1-18-12-8-3-2-5-9(12)15-14-16-10-6-4-7-11(17)13(10)19-14/h2-3,5,8H,4,6-7H2,1H3,(H,15,16) |
| InChIKey | FWKWDAVXXAUFRQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-methoxyanilino)-5,6-dihydro-4H-1,3-benzothiazol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyanilino)-5,6-dihydro-4H-1,3-benzothiazol-7-one?
The IUPAC name of 2-(2-methoxyanilino)-5,6-dihydro-4H-1,3-benzothiazol-7-one (CID 166222120) is 2-(2-methoxyanilino)-5,6-dihydro-4H-1,3-benzothiazol-7-one.
What is the SMILES notation for 2-(2-methoxyanilino)-5,6-dihydro-4H-1,3-benzothiazol-7-one?
The canonical SMILES for 2-(2-methoxyanilino)-5,6-dihydro-4H-1,3-benzothiazol-7-one is COc1ccccc1Nc1nc2c(s1)C(=O)CCC2.
What is the InChIKey of 2-(2-methoxyanilino)-5,6-dihydro-4H-1,3-benzothiazol-7-one?
The InChIKey is FWKWDAVXXAUFRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O2S/c1-18-12-8-3-2-5-9(12)15-14-16-10-6-4-7-11(17)13(10)19-14/h2-3,5,8H,4,6-7H2,1H3,(H,15,16).
What are the key properties of 2-(2-methoxyanilino)-5,6-dihydro-4H-1,3-benzothiazol-7-one?
2-(2-methoxyanilino)-5,6-dihydro-4H-1,3-benzothiazol-7-one has a molecular weight of 274.35 g/mol, XLogP of 3.41, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyanilino)-5,6-dihydro-4H-1,3-benzothiazol-7-one is sourced from PubChem (CID 166222120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).