About phenyl(spiro[2H-indole-3,1'-cyclobutane]-1-yl)methanone
phenyl(spiro[2H-indole-3,1'-cyclobutane]-1-yl)methanone (PubChem CID 166223400) has the molecular formula C18H17NO
and a molecular weight of 263.34 g/mol. Its IUPAC name is phenyl(spiro[2H-indole-3,1'-cyclobutane]-1-yl)methanone.
Molecular Properties
| Compound Name | phenyl(spiro[2H-indole-3,1'-cyclobutane]-1-yl)methanone |
| PubChem CID | 166223400 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | phenyl(spiro[2H-indole-3,1'-cyclobutane]-1-yl)methanone |
| SMILES | O=C(c1ccccc1)N1CC2(CCC2)c2ccccc21 |
| InChI | InChI=1S/C18H17NO/c20-17(14-7-2-1-3-8-14)19-13-18(11-6-12-18)15-9-4-5-10-16(15)19/h1-5,7-10H,6,11-13H2 |
| InChIKey | PXSPBZAOFNIVSO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze phenyl(spiro[2H-indole-3,1'-cyclobutane]-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl(spiro[2H-indole-3,1'-cyclobutane]-1-yl)methanone?
The IUPAC name of phenyl(spiro[2H-indole-3,1'-cyclobutane]-1-yl)methanone (CID 166223400) is phenyl(spiro[2H-indole-3,1'-cyclobutane]-1-yl)methanone.
What is the SMILES notation for phenyl(spiro[2H-indole-3,1'-cyclobutane]-1-yl)methanone?
The canonical SMILES for phenyl(spiro[2H-indole-3,1'-cyclobutane]-1-yl)methanone is O=C(c1ccccc1)N1CC2(CCC2)c2ccccc21.
What is the InChIKey of phenyl(spiro[2H-indole-3,1'-cyclobutane]-1-yl)methanone?
The InChIKey is PXSPBZAOFNIVSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO/c20-17(14-7-2-1-3-8-14)19-13-18(11-6-12-18)15-9-4-5-10-16(15)19/h1-5,7-10H,6,11-13H2.
What are the key properties of phenyl(spiro[2H-indole-3,1'-cyclobutane]-1-yl)methanone?
phenyl(spiro[2H-indole-3,1'-cyclobutane]-1-yl)methanone has a molecular weight of 263.34 g/mol, XLogP of 3.77, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl(spiro[2H-indole-3,1'-cyclobutane]-1-yl)methanone is sourced from PubChem (CID 166223400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).