About 2-[(E)-2-(1-ethylindazol-3-yl)ethenyl]-[1,3]thiazolo[4,5-c]pyridine
2-[(E)-2-(1-ethylindazol-3-yl)ethenyl]-[1,3]thiazolo[4,5-c]pyridine (PubChem CID 166224831) has the molecular formula C17H14N4S
and a molecular weight of 306.39 g/mol. Its IUPAC name is 2-[(E)-2-(1-ethylindazol-3-yl)ethenyl]-[1,3]thiazolo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 2-[(E)-2-(1-ethylindazol-3-yl)ethenyl]-[1,3]thiazolo[4,5-c]pyridine |
| PubChem CID | 166224831 |
| Molecular Formula | C17H14N4S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-[(E)-2-(1-ethylindazol-3-yl)ethenyl]-[1,3]thiazolo[4,5-c]pyridine |
| SMILES | CCn1nc(/C=C/c2nc3cnccc3s2)c2ccccc21 |
| InChI | InChI=1S/C17H14N4S/c1-2-21-15-6-4-3-5-12(15)13(20-21)7-8-17-19-14-11-18-10-9-16(14)22-17/h3-11H,2H2,1H3/b8-7+ |
| InChIKey | OSZJJKYLGVDOBA-BQYQJAHWSA-N |
| XLogP | 4.23 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(E)-2-(1-ethylindazol-3-yl)ethenyl]-[1,3]thiazolo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(1-ethylindazol-3-yl)ethenyl]-[1,3]thiazolo[4,5-c]pyridine?
The IUPAC name of 2-[(E)-2-(1-ethylindazol-3-yl)ethenyl]-[1,3]thiazolo[4,5-c]pyridine (CID 166224831) is 2-[(E)-2-(1-ethylindazol-3-yl)ethenyl]-[1,3]thiazolo[4,5-c]pyridine.
What is the SMILES notation for 2-[(E)-2-(1-ethylindazol-3-yl)ethenyl]-[1,3]thiazolo[4,5-c]pyridine?
The canonical SMILES for 2-[(E)-2-(1-ethylindazol-3-yl)ethenyl]-[1,3]thiazolo[4,5-c]pyridine is CCn1nc(/C=C/c2nc3cnccc3s2)c2ccccc21.
What is the InChIKey of 2-[(E)-2-(1-ethylindazol-3-yl)ethenyl]-[1,3]thiazolo[4,5-c]pyridine?
The InChIKey is OSZJJKYLGVDOBA-BQYQJAHWSA-N. The full InChI is InChI=1S/C17H14N4S/c1-2-21-15-6-4-3-5-12(15)13(20-21)7-8-17-19-14-11-18-10-9-16(14)22-17/h3-11H,2H2,1H3/b8-7+.
What are the key properties of 2-[(E)-2-(1-ethylindazol-3-yl)ethenyl]-[1,3]thiazolo[4,5-c]pyridine?
2-[(E)-2-(1-ethylindazol-3-yl)ethenyl]-[1,3]thiazolo[4,5-c]pyridine has a molecular weight of 306.39 g/mol, XLogP of 4.23, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(1-ethylindazol-3-yl)ethenyl]-[1,3]thiazolo[4,5-c]pyridine is sourced from PubChem (CID 166224831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).