C15H13NOS — CID 166225079
(6E)-6-(1,3-thiazol-5-ylmethylidene)-8,9-dihydro-7H-benzo[7]annulen-5-one (PubChem CID 166225079) has the molecular formula C15H13NOS and a molecular weight of 255.34 g/mol. Its IUPAC name is (6E)-6-(1,3-thiazol-5-ylmethylidene)-8,9-dihydro-7H-benzo[7]annulen-5-one.
| Compound Name | (6E)-6-(1,3-thiazol-5-ylmethylidene)-8,9-dihydro-7H-benzo[7]annulen-5-one |
|---|---|
| PubChem CID | 166225079 |
| Molecular Formula | C15H13NOS |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | (6E)-6-(1,3-thiazol-5-ylmethylidene)-8,9-dihydro-7H-benzo[7]annulen-5-one |
| SMILES | O=C1/C(=C/c2cncs2)CCCc2ccccc21 |
| InChI | InChI=1S/C15H13NOS/c17-15-12(8-13-9-16-10-18-13)6-3-5-11-4-1-2-7-14(11)15/h1-2,4,7-10H,3,5-6H2/b12-8+ |
| InChIKey | HQWYRCUCMRQYEL-XYOKQWHBSA-N |
| XLogP | 3.75 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|