C9H14N6OS — CID 166225917
3-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 166225917) has the molecular formula C9H14N6OS and a molecular weight of 254.32 g/mol. Its IUPAC name is 3-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 166225917 |
| Molecular Formula | C9H14N6OS |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 3-[[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]methyl]-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | CC(C)(C)c1nsc(NCc2n[nH]c(=O)[nH]2)n1 |
| InChI | InChI=1S/C9H14N6OS/c1-9(2,3)6-12-8(17-15-6)10-4-5-11-7(16)14-13-5/h4H2,1-3H3,(H,10,12,15)(H2,11,13,14,16) |
| InChIKey | YZQVXQZAZUGBJU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |