C18H18N4O3 — CID 166227041
N'-[4-[(2-cyano-4-pyridinyl)oxy]phenyl]-N-methylpentanediamide (PubChem CID 166227041) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is N'-[4-[(2-cyano-4-pyridinyl)oxy]phenyl]-N-methylpentanediamide.
| Compound Name | N'-[4-[(2-cyano-4-pyridinyl)oxy]phenyl]-N-methylpentanediamide |
|---|---|
| PubChem CID | 166227041 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N'-[4-[(2-cyano-4-pyridinyl)oxy]phenyl]-N-methylpentanediamide |
| SMILES | CNC(=O)CCCC(=O)Nc1ccc(Oc2ccnc(C#N)c2)cc1 |
| InChI | InChI=1S/C18H18N4O3/c1-20-17(23)3-2-4-18(24)22-13-5-7-15(8-6-13)25-16-9-10-21-14(11-16)12-19/h5-11H,2-4H2,1H3,(H,20,23)(H,22,24) |
| InChIKey | BQOMFZZHKXZRNT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |