About N-butyl-2-methyl-3-(1,3-oxazol-2-yl)aniline
N-butyl-2-methyl-3-(1,3-oxazol-2-yl)aniline (PubChem CID 166227222) has the molecular formula C14H18N2O
and a molecular weight of 230.31 g/mol. Its IUPAC name is N-butyl-2-methyl-3-(1,3-oxazol-2-yl)aniline.
Molecular Properties
| Compound Name | N-butyl-2-methyl-3-(1,3-oxazol-2-yl)aniline |
| PubChem CID | 166227222 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | N-butyl-2-methyl-3-(1,3-oxazol-2-yl)aniline |
| SMILES | CCCCNc1cccc(-c2ncco2)c1C |
| InChI | InChI=1S/C14H18N2O/c1-3-4-8-15-13-7-5-6-12(11(13)2)14-16-9-10-17-14/h5-7,9-10,15H,3-4,8H2,1-2H3 |
| InChIKey | VHECJHXIPZDZLH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2-methyl-3-(1,3-oxazol-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-methyl-3-(1,3-oxazol-2-yl)aniline?
The IUPAC name of N-butyl-2-methyl-3-(1,3-oxazol-2-yl)aniline (CID 166227222) is N-butyl-2-methyl-3-(1,3-oxazol-2-yl)aniline.
What is the SMILES notation for N-butyl-2-methyl-3-(1,3-oxazol-2-yl)aniline?
The canonical SMILES for N-butyl-2-methyl-3-(1,3-oxazol-2-yl)aniline is CCCCNc1cccc(-c2ncco2)c1C.
What is the InChIKey of N-butyl-2-methyl-3-(1,3-oxazol-2-yl)aniline?
The InChIKey is VHECJHXIPZDZLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O/c1-3-4-8-15-13-7-5-6-12(11(13)2)14-16-9-10-17-14/h5-7,9-10,15H,3-4,8H2,1-2H3.
What are the key properties of N-butyl-2-methyl-3-(1,3-oxazol-2-yl)aniline?
N-butyl-2-methyl-3-(1,3-oxazol-2-yl)aniline has a molecular weight of 230.31 g/mol, XLogP of 3.86, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-methyl-3-(1,3-oxazol-2-yl)aniline is sourced from PubChem (CID 166227222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).