C14H18N2O — CID 166227222
N-butyl-2-methyl-3-(1,3-oxazol-2-yl)aniline (PubChem CID 166227222) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is N-butyl-2-methyl-3-(1,3-oxazol-2-yl)aniline.
| Compound Name | N-butyl-2-methyl-3-(1,3-oxazol-2-yl)aniline |
|---|---|
| PubChem CID | 166227222 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | N-butyl-2-methyl-3-(1,3-oxazol-2-yl)aniline |
| SMILES | CCCCNc1cccc(-c2ncco2)c1C |
| InChI | InChI=1S/C14H18N2O/c1-3-4-8-15-13-7-5-6-12(11(13)2)14-16-9-10-17-14/h5-7,9-10,15H,3-4,8H2,1-2H3 |
| InChIKey | VHECJHXIPZDZLH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|