About (5-methyl-1H-1,2,4-triazol-3-yl)methyl 1-(3-bromophenyl)pyrazole-4-carboxylate
(5-methyl-1H-1,2,4-triazol-3-yl)methyl 1-(3-bromophenyl)pyrazole-4-carboxylate (PubChem CID 166227924) has the molecular formula C14H12BrN5O2
and a molecular weight of 362.19 g/mol. Its IUPAC name is (5-methyl-1H-1,2,4-triazol-3-yl)methyl 1-(3-bromophenyl)pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | (5-methyl-1H-1,2,4-triazol-3-yl)methyl 1-(3-bromophenyl)pyrazole-4-carboxylate |
| PubChem CID | 166227924 |
| Molecular Formula | C14H12BrN5O2 |
| Molecular Weight | 362.19 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | (5-methyl-1H-1,2,4-triazol-3-yl)methyl 1-(3-bromophenyl)pyrazole-4-carboxylate |
| SMILES | Cc1nc(COC(=O)c2cnn(-c3cccc(Br)c3)c2)n[nH]1 |
| InChI | InChI=1S/C14H12BrN5O2/c1-9-17-13(19-18-9)8-22-14(21)10-6-16-20(7-10)12-4-2-3-11(15)5-12/h2-7H,8H2,1H3,(H,17,18,19) |
| InChIKey | YEIJWQNKXBEBJM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5-methyl-1H-1,2,4-triazol-3-yl)methyl 1-(3-bromophenyl)pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1H-1,2,4-triazol-3-yl)methyl 1-(3-bromophenyl)pyrazole-4-carboxylate?
The IUPAC name of (5-methyl-1H-1,2,4-triazol-3-yl)methyl 1-(3-bromophenyl)pyrazole-4-carboxylate (CID 166227924) is (5-methyl-1H-1,2,4-triazol-3-yl)methyl 1-(3-bromophenyl)pyrazole-4-carboxylate.
What is the SMILES notation for (5-methyl-1H-1,2,4-triazol-3-yl)methyl 1-(3-bromophenyl)pyrazole-4-carboxylate?
The canonical SMILES for (5-methyl-1H-1,2,4-triazol-3-yl)methyl 1-(3-bromophenyl)pyrazole-4-carboxylate is Cc1nc(COC(=O)c2cnn(-c3cccc(Br)c3)c2)n[nH]1.
What is the InChIKey of (5-methyl-1H-1,2,4-triazol-3-yl)methyl 1-(3-bromophenyl)pyrazole-4-carboxylate?
The InChIKey is YEIJWQNKXBEBJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrN5O2/c1-9-17-13(19-18-9)8-22-14(21)10-6-16-20(7-10)12-4-2-3-11(15)5-12/h2-7H,8H2,1H3,(H,17,18,19).
What are the key properties of (5-methyl-1H-1,2,4-triazol-3-yl)methyl 1-(3-bromophenyl)pyrazole-4-carboxylate?
(5-methyl-1H-1,2,4-triazol-3-yl)methyl 1-(3-bromophenyl)pyrazole-4-carboxylate has a molecular weight of 362.19 g/mol, XLogP of 2.42, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1H-1,2,4-triazol-3-yl)methyl 1-(3-bromophenyl)pyrazole-4-carboxylate is sourced from PubChem (CID 166227924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).