C20H21N5O4S — CID 16622823
N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)-3-(2-nitroanilino)propanamide (PubChem CID 16622823) has the molecular formula C20H21N5O4S and a molecular weight of 427.49 g/mol. Its IUPAC name is N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)-3-(2-nitroanilino)propanamide.
| Compound Name | N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)-3-(2-nitroanilino)propanamide |
|---|---|
| PubChem CID | 16622823 |
| Molecular Formula | C20H21N5O4S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)-3-(2-nitroanilino)propanamide |
| SMILES | O=C(CCNc1ccccc1[N+](=O)[O-])Nc1ccc2nc(N3CCOCC3)sc2c1 |
| InChI | InChI=1S/C20H21N5O4S/c26-19(7-8-21-15-3-1-2-4-17(15)25(27)28)22-14-5-6-16-18(13-14)30-20(23-16)24-9-11-29-12-10-24/h1-6,13,21H,7-12H2,(H,22,26) |
| InChIKey | JACOFARQXRILJF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|