C28H28FNO3 — CID 166228602
[1-(2-fluorophenoxy)cyclopropyl]-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]methanone (PubChem CID 166228602) has the molecular formula C28H28FNO3 and a molecular weight of 445.53 g/mol. Its IUPAC name is [1-(2-fluorophenoxy)cyclopropyl]-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]methanone.
| Compound Name | [1-(2-fluorophenoxy)cyclopropyl]-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 166228602 |
| Molecular Formula | C28H28FNO3 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | [1-(2-fluorophenoxy)cyclopropyl]-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]methanone |
| SMILES | O=C(N1CCC(C(O)(c2ccccc2)c2ccccc2)CC1)C1(Oc2ccccc2F)CC1 |
| InChI | InChI=1S/C28H28FNO3/c29-24-13-7-8-14-25(24)33-27(17-18-27)26(31)30-19-15-23(16-20-30)28(32,21-9-3-1-4-10-21)22-11-5-2-6-12-22/h1-14,23,32H,15-20H2 |
| InChIKey | MUMNUZDHKMNEBZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |