C11H13N3O2S — CID 166228737
5-[(3,4-dimethylphenyl)methylsulfonyl]-1H-1,2,4-triazole (PubChem CID 166228737) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 5-[(3,4-dimethylphenyl)methylsulfonyl]-1H-1,2,4-triazole.
| Compound Name | 5-[(3,4-dimethylphenyl)methylsulfonyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 166228737 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 5-[(3,4-dimethylphenyl)methylsulfonyl]-1H-1,2,4-triazole |
| SMILES | Cc1ccc(CS(=O)(=O)c2ncn[nH]2)cc1C |
| InChI | InChI=1S/C11H13N3O2S/c1-8-3-4-10(5-9(8)2)6-17(15,16)11-12-7-13-14-11/h3-5,7H,6H2,1-2H3,(H,12,13,14) |
| InChIKey | GLDTVVYBRDVLAT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |