C17H16Cl2N2O3 — CID 166229660
2-(2,3-dichlorophenyl)ethyl 4-[(2-amino-2-oxoethyl)amino]benzoate (PubChem CID 166229660) has the molecular formula C17H16Cl2N2O3 and a molecular weight of 367.23 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)ethyl 4-[(2-amino-2-oxoethyl)amino]benzoate.
| Compound Name | 2-(2,3-dichlorophenyl)ethyl 4-[(2-amino-2-oxoethyl)amino]benzoate |
|---|---|
| PubChem CID | 166229660 |
| Molecular Formula | C17H16Cl2N2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 2-(2,3-dichlorophenyl)ethyl 4-[(2-amino-2-oxoethyl)amino]benzoate |
| SMILES | NC(=O)CNc1ccc(C(=O)OCCc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C17H16Cl2N2O3/c18-14-3-1-2-11(16(14)19)8-9-24-17(23)12-4-6-13(7-5-12)21-10-15(20)22/h1-7,21H,8-10H2,(H2,20,22) |
| InChIKey | ZYZQWOVXSPAWBI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |