About [1-(2-chlorophenyl)triazol-4-yl]methyl 2-oxo-3H-1,3-benzoxazole-6-carboxylate
[1-(2-chlorophenyl)triazol-4-yl]methyl 2-oxo-3H-1,3-benzoxazole-6-carboxylate (PubChem CID 166230021) has the molecular formula C17H11ClN4O4
and a molecular weight of 370.75 g/mol. Its IUPAC name is [1-(2-chlorophenyl)triazol-4-yl]methyl 2-oxo-3H-1,3-benzoxazole-6-carboxylate.
Molecular Properties
| Compound Name | [1-(2-chlorophenyl)triazol-4-yl]methyl 2-oxo-3H-1,3-benzoxazole-6-carboxylate |
| PubChem CID | 166230021 |
| Molecular Formula | C17H11ClN4O4 |
| Molecular Weight | 370.75 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | [1-(2-chlorophenyl)triazol-4-yl]methyl 2-oxo-3H-1,3-benzoxazole-6-carboxylate |
| SMILES | O=C(OCc1cn(-c2ccccc2Cl)nn1)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C17H11ClN4O4/c18-12-3-1-2-4-14(12)22-8-11(20-21-22)9-25-16(23)10-5-6-13-15(7-10)26-17(24)19-13/h1-8H,9H2,(H,19,24) |
| InChIKey | WRIOASQPFVMNDV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.75 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-(2-chlorophenyl)triazol-4-yl]methyl 2-oxo-3H-1,3-benzoxazole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2-chlorophenyl)triazol-4-yl]methyl 2-oxo-3H-1,3-benzoxazole-6-carboxylate?
The IUPAC name of [1-(2-chlorophenyl)triazol-4-yl]methyl 2-oxo-3H-1,3-benzoxazole-6-carboxylate (CID 166230021) is [1-(2-chlorophenyl)triazol-4-yl]methyl 2-oxo-3H-1,3-benzoxazole-6-carboxylate.
What is the SMILES notation for [1-(2-chlorophenyl)triazol-4-yl]methyl 2-oxo-3H-1,3-benzoxazole-6-carboxylate?
The canonical SMILES for [1-(2-chlorophenyl)triazol-4-yl]methyl 2-oxo-3H-1,3-benzoxazole-6-carboxylate is O=C(OCc1cn(-c2ccccc2Cl)nn1)c1ccc2[nH]c(=O)oc2c1.
What is the InChIKey of [1-(2-chlorophenyl)triazol-4-yl]methyl 2-oxo-3H-1,3-benzoxazole-6-carboxylate?
The InChIKey is WRIOASQPFVMNDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11ClN4O4/c18-12-3-1-2-4-14(12)22-8-11(20-21-22)9-25-16(23)10-5-6-13-15(7-10)26-17(24)19-13/h1-8H,9H2,(H,19,24).
What are the key properties of [1-(2-chlorophenyl)triazol-4-yl]methyl 2-oxo-3H-1,3-benzoxazole-6-carboxylate?
[1-(2-chlorophenyl)triazol-4-yl]methyl 2-oxo-3H-1,3-benzoxazole-6-carboxylate has a molecular weight of 370.75 g/mol, XLogP of 2.71, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2-chlorophenyl)triazol-4-yl]methyl 2-oxo-3H-1,3-benzoxazole-6-carboxylate is sourced from PubChem (CID 166230021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).