C16H12F2N2O5S — CID 166230506
2-(2,2-difluoroethoxy)-N-(2-oxochromen-6-yl)pyridine-3-sulfonamide (PubChem CID 166230506) has the molecular formula C16H12F2N2O5S and a molecular weight of 382.34 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-N-(2-oxochromen-6-yl)pyridine-3-sulfonamide.
| Compound Name | 2-(2,2-difluoroethoxy)-N-(2-oxochromen-6-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 166230506 |
| Molecular Formula | C16H12F2N2O5S |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-N-(2-oxochromen-6-yl)pyridine-3-sulfonamide |
| SMILES | O=c1ccc2cc(NS(=O)(=O)c3cccnc3OCC(F)F)ccc2o1 |
| InChI | InChI=1S/C16H12F2N2O5S/c17-14(18)9-24-16-13(2-1-7-19-16)26(22,23)20-11-4-5-12-10(8-11)3-6-15(21)25-12/h1-8,14,20H,9H2 |
| InChIKey | OILUKBMYWHCMOQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|