C15H8F2N4O3 — CID 166230707
2,5-difluoro-N-(1,5-naphthyridin-4-yl)-4-nitrobenzamide (PubChem CID 166230707) has the molecular formula C15H8F2N4O3 and a molecular weight of 330.25 g/mol. Its IUPAC name is 2,5-difluoro-N-(1,5-naphthyridin-4-yl)-4-nitrobenzamide.
| Compound Name | 2,5-difluoro-N-(1,5-naphthyridin-4-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 166230707 |
| Molecular Formula | C15H8F2N4O3 |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 2,5-difluoro-N-(1,5-naphthyridin-4-yl)-4-nitrobenzamide |
| SMILES | O=C(Nc1ccnc2cccnc12)c1cc(F)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C15H8F2N4O3/c16-9-7-13(21(23)24)10(17)6-8(9)15(22)20-12-3-5-18-11-2-1-4-19-14(11)12/h1-7H,(H,18,20,22) |
| InChIKey | SSSMLIWXIBIOBK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|