About N'-(3-hydroxybutyl)-N'-methyl-N-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]oxamide
N'-(3-hydroxybutyl)-N'-methyl-N-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]oxamide (PubChem CID 166231711) has the molecular formula C17H19F3N4O3
and a molecular weight of 384.36 g/mol. Its IUPAC name is N'-(3-hydroxybutyl)-N'-methyl-N-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]oxamide.
Molecular Properties
| Compound Name | N'-(3-hydroxybutyl)-N'-methyl-N-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]oxamide |
| PubChem CID | 166231711 |
| Molecular Formula | C17H19F3N4O3 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N'-(3-hydroxybutyl)-N'-methyl-N-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]oxamide |
| SMILES | CC(O)CCN(C)C(=O)C(=O)Nc1cnn(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C17H19F3N4O3/c1-11(25)7-8-23(2)16(27)15(26)22-13-9-21-24(10-13)14-5-3-12(4-6-14)17(18,19)20/h3-6,9-11,25H,7-8H2,1-2H3,(H,22,26) |
| InChIKey | CNVYDNIHNRKXCS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-(3-hydroxybutyl)-N'-methyl-N-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-hydroxybutyl)-N'-methyl-N-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]oxamide?
The IUPAC name of N'-(3-hydroxybutyl)-N'-methyl-N-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]oxamide (CID 166231711) is N'-(3-hydroxybutyl)-N'-methyl-N-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]oxamide.
What is the SMILES notation for N'-(3-hydroxybutyl)-N'-methyl-N-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]oxamide?
The canonical SMILES for N'-(3-hydroxybutyl)-N'-methyl-N-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]oxamide is CC(O)CCN(C)C(=O)C(=O)Nc1cnn(-c2ccc(C(F)(F)F)cc2)c1.
What is the InChIKey of N'-(3-hydroxybutyl)-N'-methyl-N-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]oxamide?
The InChIKey is CNVYDNIHNRKXCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F3N4O3/c1-11(25)7-8-23(2)16(27)15(26)22-13-9-21-24(10-13)14-5-3-12(4-6-14)17(18,19)20/h3-6,9-11,25H,7-8H2,1-2H3,(H,22,26).
What are the key properties of N'-(3-hydroxybutyl)-N'-methyl-N-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]oxamide?
N'-(3-hydroxybutyl)-N'-methyl-N-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]oxamide has a molecular weight of 384.36 g/mol, XLogP of 2.06, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-hydroxybutyl)-N'-methyl-N-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]oxamide is sourced from PubChem (CID 166231711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).