About 2-(7-ethyl-1H-indol-3-yl)-1-(1-methyl-2,3-dihydropyrido[3,4-b]pyrazin-4-yl)ethanone
2-(7-ethyl-1H-indol-3-yl)-1-(1-methyl-2,3-dihydropyrido[3,4-b]pyrazin-4-yl)ethanone (PubChem CID 166231825) has the molecular formula C20H22N4O
and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-(7-ethyl-1H-indol-3-yl)-1-(1-methyl-2,3-dihydropyrido[3,4-b]pyrazin-4-yl)ethanone.
Molecular Properties
| Compound Name | 2-(7-ethyl-1H-indol-3-yl)-1-(1-methyl-2,3-dihydropyrido[3,4-b]pyrazin-4-yl)ethanone |
| PubChem CID | 166231825 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-(7-ethyl-1H-indol-3-yl)-1-(1-methyl-2,3-dihydropyrido[3,4-b]pyrazin-4-yl)ethanone |
| SMILES | CCc1cccc2c(CC(=O)N3CCN(C)c4ccncc43)c[nH]c12 |
| InChI | InChI=1S/C20H22N4O/c1-3-14-5-4-6-16-15(12-22-20(14)16)11-19(25)24-10-9-23(2)17-7-8-21-13-18(17)24/h4-8,12-13,22H,3,9-11H2,1-2H3 |
| InChIKey | VFCXVAXWZAGZHH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(7-ethyl-1H-indol-3-yl)-1-(1-methyl-2,3-dihydropyrido[3,4-b]pyrazin-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-ethyl-1H-indol-3-yl)-1-(1-methyl-2,3-dihydropyrido[3,4-b]pyrazin-4-yl)ethanone?
The IUPAC name of 2-(7-ethyl-1H-indol-3-yl)-1-(1-methyl-2,3-dihydropyrido[3,4-b]pyrazin-4-yl)ethanone (CID 166231825) is 2-(7-ethyl-1H-indol-3-yl)-1-(1-methyl-2,3-dihydropyrido[3,4-b]pyrazin-4-yl)ethanone.
What is the SMILES notation for 2-(7-ethyl-1H-indol-3-yl)-1-(1-methyl-2,3-dihydropyrido[3,4-b]pyrazin-4-yl)ethanone?
The canonical SMILES for 2-(7-ethyl-1H-indol-3-yl)-1-(1-methyl-2,3-dihydropyrido[3,4-b]pyrazin-4-yl)ethanone is CCc1cccc2c(CC(=O)N3CCN(C)c4ccncc43)c[nH]c12.
What is the InChIKey of 2-(7-ethyl-1H-indol-3-yl)-1-(1-methyl-2,3-dihydropyrido[3,4-b]pyrazin-4-yl)ethanone?
The InChIKey is VFCXVAXWZAGZHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O/c1-3-14-5-4-6-16-15(12-22-20(14)16)11-19(25)24-10-9-23(2)17-7-8-21-13-18(17)24/h4-8,12-13,22H,3,9-11H2,1-2H3.
What are the key properties of 2-(7-ethyl-1H-indol-3-yl)-1-(1-methyl-2,3-dihydropyrido[3,4-b]pyrazin-4-yl)ethanone?
2-(7-ethyl-1H-indol-3-yl)-1-(1-methyl-2,3-dihydropyrido[3,4-b]pyrazin-4-yl)ethanone has a molecular weight of 334.42 g/mol, XLogP of 3.15, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-ethyl-1H-indol-3-yl)-1-(1-methyl-2,3-dihydropyrido[3,4-b]pyrazin-4-yl)ethanone is sourced from PubChem (CID 166231825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).