C21H28N2O3 — CID 166232672
N'-(3,5-dimethoxyphenyl)-N-(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)ethane-1,2-diamine (PubChem CID 166232672) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is N'-(3,5-dimethoxyphenyl)-N-(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)ethane-1,2-diamine.
| Compound Name | N'-(3,5-dimethoxyphenyl)-N-(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 166232672 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | N'-(3,5-dimethoxyphenyl)-N-(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)ethane-1,2-diamine |
| SMILES | COc1cc(NCCNC2CCCc3c(OC)cccc32)cc(OC)c1 |
| InChI | InChI=1S/C21H28N2O3/c1-24-16-12-15(13-17(14-16)25-2)22-10-11-23-20-8-4-7-19-18(20)6-5-9-21(19)26-3/h5-6,9,12-14,20,22-23H,4,7-8,10-11H2,1-3H3 |
| InChIKey | VVRBNYAGPKTCTH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|