About 4-(1,6-naphthyridin-4-yl)-1,4-thiazepane
4-(1,6-naphthyridin-4-yl)-1,4-thiazepane (PubChem CID 166233200) has the molecular formula C13H15N3S
and a molecular weight of 245.35 g/mol. Its IUPAC name is 4-(1,6-naphthyridin-4-yl)-1,4-thiazepane.
Molecular Properties
| Compound Name | 4-(1,6-naphthyridin-4-yl)-1,4-thiazepane |
| PubChem CID | 166233200 |
| Molecular Formula | C13H15N3S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 4-(1,6-naphthyridin-4-yl)-1,4-thiazepane |
| SMILES | c1cc2nccc(N3CCCSCC3)c2cn1 |
| InChI | InChI=1S/C13H15N3S/c1-6-16(7-9-17-8-1)13-3-5-15-12-2-4-14-10-11(12)13/h2-5,10H,1,6-9H2 |
| InChIKey | HILLYPWURJHQPY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,6-naphthyridin-4-yl)-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,6-naphthyridin-4-yl)-1,4-thiazepane?
The IUPAC name of 4-(1,6-naphthyridin-4-yl)-1,4-thiazepane (CID 166233200) is 4-(1,6-naphthyridin-4-yl)-1,4-thiazepane.
What is the SMILES notation for 4-(1,6-naphthyridin-4-yl)-1,4-thiazepane?
The canonical SMILES for 4-(1,6-naphthyridin-4-yl)-1,4-thiazepane is c1cc2nccc(N3CCCSCC3)c2cn1.
What is the InChIKey of 4-(1,6-naphthyridin-4-yl)-1,4-thiazepane?
The InChIKey is HILLYPWURJHQPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3S/c1-6-16(7-9-17-8-1)13-3-5-15-12-2-4-14-10-11(12)13/h2-5,10H,1,6-9H2.
What are the key properties of 4-(1,6-naphthyridin-4-yl)-1,4-thiazepane?
4-(1,6-naphthyridin-4-yl)-1,4-thiazepane has a molecular weight of 245.35 g/mol, XLogP of 2.57, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,6-naphthyridin-4-yl)-1,4-thiazepane is sourced from PubChem (CID 166233200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).