About N,N'-bis(4-methoxy-6-methylpyrimidin-2-yl)-N'-methylethane-1,2-diamine
N,N'-bis(4-methoxy-6-methylpyrimidin-2-yl)-N'-methylethane-1,2-diamine (PubChem CID 166233772) has the molecular formula C15H22N6O2
and a molecular weight of 318.38 g/mol. Its IUPAC name is N,N'-bis(4-methoxy-6-methylpyrimidin-2-yl)-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N,N'-bis(4-methoxy-6-methylpyrimidin-2-yl)-N'-methylethane-1,2-diamine |
| PubChem CID | 166233772 |
| Molecular Formula | C15H22N6O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | N,N'-bis(4-methoxy-6-methylpyrimidin-2-yl)-N'-methylethane-1,2-diamine |
| SMILES | COc1cc(C)nc(NCCN(C)c2nc(C)cc(OC)n2)n1 |
| InChI | InChI=1S/C15H22N6O2/c1-10-8-12(22-4)19-14(17-10)16-6-7-21(3)15-18-11(2)9-13(20-15)23-5/h8-9H,6-7H2,1-5H3,(H,16,17,19) |
| InChIKey | VRRUIEFMRGKSEN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N,N'-bis(4-methoxy-6-methylpyrimidin-2-yl)-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(4-methoxy-6-methylpyrimidin-2-yl)-N'-methylethane-1,2-diamine?
The IUPAC name of N,N'-bis(4-methoxy-6-methylpyrimidin-2-yl)-N'-methylethane-1,2-diamine (CID 166233772) is N,N'-bis(4-methoxy-6-methylpyrimidin-2-yl)-N'-methylethane-1,2-diamine.
What is the SMILES notation for N,N'-bis(4-methoxy-6-methylpyrimidin-2-yl)-N'-methylethane-1,2-diamine?
The canonical SMILES for N,N'-bis(4-methoxy-6-methylpyrimidin-2-yl)-N'-methylethane-1,2-diamine is COc1cc(C)nc(NCCN(C)c2nc(C)cc(OC)n2)n1.
What is the InChIKey of N,N'-bis(4-methoxy-6-methylpyrimidin-2-yl)-N'-methylethane-1,2-diamine?
The InChIKey is VRRUIEFMRGKSEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N6O2/c1-10-8-12(22-4)19-14(17-10)16-6-7-21(3)15-18-11(2)9-13(20-15)23-5/h8-9H,6-7H2,1-5H3,(H,16,17,19).
What are the key properties of N,N'-bis(4-methoxy-6-methylpyrimidin-2-yl)-N'-methylethane-1,2-diamine?
N,N'-bis(4-methoxy-6-methylpyrimidin-2-yl)-N'-methylethane-1,2-diamine has a molecular weight of 318.38 g/mol, XLogP of 1.45, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(4-methoxy-6-methylpyrimidin-2-yl)-N'-methylethane-1,2-diamine is sourced from PubChem (CID 166233772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).