C15H22F3N7O2S — CID 166233808
4-[(3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyrazin-8-yl)amino]-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide (PubChem CID 166233808) has the molecular formula C15H22F3N7O2S and a molecular weight of 421.45 g/mol. Its IUPAC name is 4-[(3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyrazin-8-yl)amino]-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide.
| Compound Name | 4-[(3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyrazin-8-yl)amino]-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 166233808 |
| Molecular Formula | C15H22F3N7O2S |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 4-[(3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyrazin-8-yl)amino]-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide |
| SMILES | CC(C)c1nnc2c(NC3CCN(S(=O)(=O)NCC(F)(F)F)CC3)nccn12 |
| InChI | InChI=1S/C15H22F3N7O2S/c1-10(2)13-22-23-14-12(19-5-8-25(13)14)21-11-3-6-24(7-4-11)28(26,27)20-9-15(16,17)18/h5,8,10-11,20H,3-4,6-7,9H2,1-2H3,(H,19,21) |
| InChIKey | VCYWYIHSSJTORU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |