About 3-[3-[(4,5-dimethylimidazol-1-yl)methyl]phenyl]-1-(1-phenylethyl)imidazolidine-2,4-dione
3-[3-[(4,5-dimethylimidazol-1-yl)methyl]phenyl]-1-(1-phenylethyl)imidazolidine-2,4-dione (PubChem CID 166233895) has the molecular formula C23H24N4O2
and a molecular weight of 388.47 g/mol. Its IUPAC name is 3-[3-[(4,5-dimethylimidazol-1-yl)methyl]phenyl]-1-(1-phenylethyl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-[3-[(4,5-dimethylimidazol-1-yl)methyl]phenyl]-1-(1-phenylethyl)imidazolidine-2,4-dione |
| PubChem CID | 166233895 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 3-[3-[(4,5-dimethylimidazol-1-yl)methyl]phenyl]-1-(1-phenylethyl)imidazolidine-2,4-dione |
| SMILES | Cc1ncn(Cc2cccc(N3C(=O)CN(C(C)c4ccccc4)C3=O)c2)c1C |
| InChI | InChI=1S/C23H24N4O2/c1-16-17(2)25(15-24-16)13-19-8-7-11-21(12-19)27-22(28)14-26(23(27)29)18(3)20-9-5-4-6-10-20/h4-12,15,18H,13-14H2,1-3H3 |
| InChIKey | JRLVNJZWTCIYOG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[(4,5-dimethylimidazol-1-yl)methyl]phenyl]-1-(1-phenylethyl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[(4,5-dimethylimidazol-1-yl)methyl]phenyl]-1-(1-phenylethyl)imidazolidine-2,4-dione?
The IUPAC name of 3-[3-[(4,5-dimethylimidazol-1-yl)methyl]phenyl]-1-(1-phenylethyl)imidazolidine-2,4-dione (CID 166233895) is 3-[3-[(4,5-dimethylimidazol-1-yl)methyl]phenyl]-1-(1-phenylethyl)imidazolidine-2,4-dione.
What is the SMILES notation for 3-[3-[(4,5-dimethylimidazol-1-yl)methyl]phenyl]-1-(1-phenylethyl)imidazolidine-2,4-dione?
The canonical SMILES for 3-[3-[(4,5-dimethylimidazol-1-yl)methyl]phenyl]-1-(1-phenylethyl)imidazolidine-2,4-dione is Cc1ncn(Cc2cccc(N3C(=O)CN(C(C)c4ccccc4)C3=O)c2)c1C.
What is the InChIKey of 3-[3-[(4,5-dimethylimidazol-1-yl)methyl]phenyl]-1-(1-phenylethyl)imidazolidine-2,4-dione?
The InChIKey is JRLVNJZWTCIYOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N4O2/c1-16-17(2)25(15-24-16)13-19-8-7-11-21(12-19)27-22(28)14-26(23(27)29)18(3)20-9-5-4-6-10-20/h4-12,15,18H,13-14H2,1-3H3.
What are the key properties of 3-[3-[(4,5-dimethylimidazol-1-yl)methyl]phenyl]-1-(1-phenylethyl)imidazolidine-2,4-dione?
3-[3-[(4,5-dimethylimidazol-1-yl)methyl]phenyl]-1-(1-phenylethyl)imidazolidine-2,4-dione has a molecular weight of 388.47 g/mol, XLogP of 4.08, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[(4,5-dimethylimidazol-1-yl)methyl]phenyl]-1-(1-phenylethyl)imidazolidine-2,4-dione is sourced from PubChem (CID 166233895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).