C16H16N2O3S2 — CID 166234453
N-[3-[(E)-3-(4-cyclopropyl-1,3-thiazol-5-yl)prop-2-enoyl]phenyl]methanesulfonamide (PubChem CID 166234453) has the molecular formula C16H16N2O3S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is N-[3-[(E)-3-(4-cyclopropyl-1,3-thiazol-5-yl)prop-2-enoyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[(E)-3-(4-cyclopropyl-1,3-thiazol-5-yl)prop-2-enoyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 166234453 |
| Molecular Formula | C16H16N2O3S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | N-[3-[(E)-3-(4-cyclopropyl-1,3-thiazol-5-yl)prop-2-enoyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(C(=O)/C=C/c2scnc2C2CC2)c1 |
| InChI | InChI=1S/C16H16N2O3S2/c1-23(20,21)18-13-4-2-3-12(9-13)14(19)7-8-15-16(11-5-6-11)17-10-22-15/h2-4,7-11,18H,5-6H2,1H3/b8-7+ |
| InChIKey | DRJMRZNNHNMDJE-BQYQJAHWSA-N |
| XLogP | 3.29 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|