C22H30N4O6 — CID 166234532
1-N,4-N-bis[(1-methyl-2,5-dioxopyrrolidin-3-yl)methyl]bicyclo[2.2.2]octane-1,4-dicarboxamide (PubChem CID 166234532) has the molecular formula C22H30N4O6 and a molecular weight of 446.50 g/mol. Its IUPAC name is 1-N,4-N-bis[(1-methyl-2,5-dioxopyrrolidin-3-yl)methyl]bicyclo[2.2.2]octane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[(1-methyl-2,5-dioxopyrrolidin-3-yl)methyl]bicyclo[2.2.2]octane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 166234532 |
| Molecular Formula | C22H30N4O6 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 1-N,4-N-bis[(1-methyl-2,5-dioxopyrrolidin-3-yl)methyl]bicyclo[2.2.2]octane-1,4-dicarboxamide |
| SMILES | CN1C(=O)CC(CNC(=O)C23CCC(C(=O)NCC4CC(=O)N(C)C4=O)(CC2)CC3)C1=O |
| InChI | InChI=1S/C22H30N4O6/c1-25-15(27)9-13(17(25)29)11-23-19(31)21-3-6-22(7-4-21,8-5-21)20(32)24-12-14-10-16(28)26(2)18(14)30/h13-14H,3-12H2,1-2H3,(H,23,31)(H,24,32) |
| InChIKey | KEGHXOOFVDKMHX-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|