C16H21ClN2O2 — CID 166236364
1-[(3aR,6aS)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrol-1-yl]-2-(2-chloroanilino)ethanone (PubChem CID 166236364) has the molecular formula C16H21ClN2O2 and a molecular weight of 308.81 g/mol. Its IUPAC name is 1-[(3aR,6aS)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrol-1-yl]-2-(2-chloroanilino)ethanone.
| Compound Name | 1-[(3aR,6aS)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrol-1-yl]-2-(2-chloroanilino)ethanone |
|---|---|
| PubChem CID | 166236364 |
| Molecular Formula | C16H21ClN2O2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-[(3aR,6aS)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrol-1-yl]-2-(2-chloroanilino)ethanone |
| SMILES | CC1(C)CN(C(=O)CNc2ccccc2Cl)[C@@H]2COC[C@@H]21 |
| InChI | InChI=1S/C16H21ClN2O2/c1-16(2)10-19(14-9-21-8-11(14)16)15(20)7-18-13-6-4-3-5-12(13)17/h3-6,11,14,18H,7-10H2,1-2H3/t11-,14+/m0/s1 |
| InChIKey | BCQSDPDKNNLURS-SMDDNHRTSA-N |
| XLogP | 2.64 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |