C18H24FNO4S — CID 166236365
1-[(3aS,6aR)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrol-1-yl]-3-(4-fluorophenyl)sulfonylbutan-1-one (PubChem CID 166236365) has the molecular formula C18H24FNO4S and a molecular weight of 369.46 g/mol. Its IUPAC name is 1-[(3aS,6aR)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrol-1-yl]-3-(4-fluorophenyl)sulfonylbutan-1-one.
| Compound Name | 1-[(3aS,6aR)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrol-1-yl]-3-(4-fluorophenyl)sulfonylbutan-1-one |
|---|---|
| PubChem CID | 166236365 |
| Molecular Formula | C18H24FNO4S |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-[(3aS,6aR)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrol-1-yl]-3-(4-fluorophenyl)sulfonylbutan-1-one |
| SMILES | CC(CC(=O)N1CC(C)(C)[C@@H]2COC[C@@H]21)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H24FNO4S/c1-12(25(22,23)14-6-4-13(19)5-7-14)8-17(21)20-11-18(2,3)15-9-24-10-16(15)20/h4-7,12,15-16H,8-11H2,1-3H3/t12?,15-,16+/m1/s1 |
| InChIKey | GIZZFOSANPNJFG-AGIABQAESA-N |
| XLogP | 2.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |