C18H30F3N3O3 — CID 166236609
N-(3-methoxyspiro[3.3]heptan-1-yl)-4-[3-(2,2,2-trifluoroethoxy)propyl]piperazine-1-carboxamide (PubChem CID 166236609) has the molecular formula C18H30F3N3O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is N-(3-methoxyspiro[3.3]heptan-1-yl)-4-[3-(2,2,2-trifluoroethoxy)propyl]piperazine-1-carboxamide.
| Compound Name | N-(3-methoxyspiro[3.3]heptan-1-yl)-4-[3-(2,2,2-trifluoroethoxy)propyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 166236609 |
| Molecular Formula | C18H30F3N3O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N-(3-methoxyspiro[3.3]heptan-1-yl)-4-[3-(2,2,2-trifluoroethoxy)propyl]piperazine-1-carboxamide |
| SMILES | COC1CC(NC(=O)N2CCN(CCCOCC(F)(F)F)CC2)C12CCC2 |
| InChI | InChI=1S/C18H30F3N3O3/c1-26-15-12-14(17(15)4-2-5-17)22-16(25)24-9-7-23(8-10-24)6-3-11-27-13-18(19,20)21/h14-15H,2-13H2,1H3,(H,22,25) |
| InChIKey | APPITSNBEMEWDI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|