C20H22N4 — CID 166236703
4-methyl-3-[1-[(3-phenyl-1H-pyrazol-5-yl)methyl]pyrrolidin-3-yl]pyridine (PubChem CID 166236703) has the molecular formula C20H22N4 and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-methyl-3-[1-[(3-phenyl-1H-pyrazol-5-yl)methyl]pyrrolidin-3-yl]pyridine.
| Compound Name | 4-methyl-3-[1-[(3-phenyl-1H-pyrazol-5-yl)methyl]pyrrolidin-3-yl]pyridine |
|---|---|
| PubChem CID | 166236703 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 4-methyl-3-[1-[(3-phenyl-1H-pyrazol-5-yl)methyl]pyrrolidin-3-yl]pyridine |
| SMILES | Cc1ccncc1C1CCN(Cc2cc(-c3ccccc3)n[nH]2)C1 |
| InChI | InChI=1S/C20H22N4/c1-15-7-9-21-12-19(15)17-8-10-24(13-17)14-18-11-20(23-22-18)16-5-3-2-4-6-16/h2-7,9,11-12,17H,8,10,13-14H2,1H3,(H,22,23) |
| InChIKey | KDZHHTPUNUVTRA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |