C19H20N6O2 — CID 166236817
2-[3-(1-methylimidazol-2-yl)pyrrolidin-1-yl]-2-oxo-N-(1-phenylimidazol-2-yl)acetamide (PubChem CID 166236817) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is 2-[3-(1-methylimidazol-2-yl)pyrrolidin-1-yl]-2-oxo-N-(1-phenylimidazol-2-yl)acetamide.
| Compound Name | 2-[3-(1-methylimidazol-2-yl)pyrrolidin-1-yl]-2-oxo-N-(1-phenylimidazol-2-yl)acetamide |
|---|---|
| PubChem CID | 166236817 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-[3-(1-methylimidazol-2-yl)pyrrolidin-1-yl]-2-oxo-N-(1-phenylimidazol-2-yl)acetamide |
| SMILES | Cn1ccnc1C1CCN(C(=O)C(=O)Nc2nccn2-c2ccccc2)C1 |
| InChI | InChI=1S/C19H20N6O2/c1-23-11-8-20-16(23)14-7-10-24(13-14)18(27)17(26)22-19-21-9-12-25(19)15-5-3-2-4-6-15/h2-6,8-9,11-12,14H,7,10,13H2,1H3,(H,21,22,26) |
| InChIKey | QFXQAMGDWOYKTP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|