C14H15F3N4OS — CID 166237009
1-[1-(thiadiazol-4-yl)ethyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 166237009) has the molecular formula C14H15F3N4OS and a molecular weight of 344.36 g/mol. Its IUPAC name is 1-[1-(thiadiazol-4-yl)ethyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea.
| Compound Name | 1-[1-(thiadiazol-4-yl)ethyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 166237009 |
| Molecular Formula | C14H15F3N4OS |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 1-[1-(thiadiazol-4-yl)ethyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | CC(NC(=O)NCCc1ccc(C(F)(F)F)cc1)c1csnn1 |
| InChI | InChI=1S/C14H15F3N4OS/c1-9(12-8-23-21-20-12)19-13(22)18-7-6-10-2-4-11(5-3-10)14(15,16)17/h2-5,8-9H,6-7H2,1H3,(H2,18,19,22) |
| InChIKey | XSLWHMFALOAPFJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |