C15H21N5OS — CID 166237134
2-phenylsulfanyl-N-[1-(2H-tetrazol-5-yl)butyl]butanamide (PubChem CID 166237134) has the molecular formula C15H21N5OS and a molecular weight of 319.43 g/mol. Its IUPAC name is 2-phenylsulfanyl-N-[1-(2H-tetrazol-5-yl)butyl]butanamide.
| Compound Name | 2-phenylsulfanyl-N-[1-(2H-tetrazol-5-yl)butyl]butanamide |
|---|---|
| PubChem CID | 166237134 |
| Molecular Formula | C15H21N5OS |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2-phenylsulfanyl-N-[1-(2H-tetrazol-5-yl)butyl]butanamide |
| SMILES | CCCC(NC(=O)C(CC)Sc1ccccc1)c1nn[nH]n1 |
| InChI | InChI=1S/C15H21N5OS/c1-3-8-12(14-17-19-20-18-14)16-15(21)13(4-2)22-11-9-6-5-7-10-11/h5-7,9-10,12-13H,3-4,8H2,1-2H3,(H,16,21)(H,17,18,19,20) |
| InChIKey | MCIGAMNKMAPHBT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |