C19H24FNO3S — CID 166237203
1-(3-fluoro-4-methylsulfonylphenyl)-N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]ethanamine (PubChem CID 166237203) has the molecular formula C19H24FNO3S and a molecular weight of 365.47 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylsulfonylphenyl)-N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]ethanamine.
| Compound Name | 1-(3-fluoro-4-methylsulfonylphenyl)-N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]ethanamine |
|---|---|
| PubChem CID | 166237203 |
| Molecular Formula | C19H24FNO3S |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 1-(3-fluoro-4-methylsulfonylphenyl)-N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]ethanamine |
| SMILES | COc1ccc(C)cc1[C@@H](C)NC(C)c1ccc(S(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C19H24FNO3S/c1-12-6-8-18(24-4)16(10-12)14(3)21-13(2)15-7-9-19(17(20)11-15)25(5,22)23/h6-11,13-14,21H,1-5H3/t13?,14-/m1/s1 |
| InChIKey | HNZNFSHAQDAVHG-ARLHGKGLSA-N |
| XLogP | 3.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |