C13H14F3N5O4 — CID 166237591
4-[(6-pyrazol-1-ylpyrazin-2-yl)amino]butanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 166237591) has the molecular formula C13H14F3N5O4 and a molecular weight of 361.28 g/mol. Its IUPAC name is 4-[(6-pyrazol-1-ylpyrazin-2-yl)amino]butanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[(6-pyrazol-1-ylpyrazin-2-yl)amino]butanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166237591 |
| Molecular Formula | C13H14F3N5O4 |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 4-[(6-pyrazol-1-ylpyrazin-2-yl)amino]butanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCCNc1cncc(-n2cccn2)n1 |
| InChI | InChI=1S/C11H13N5O2.C2HF3O2/c17-11(18)3-1-4-13-9-7-12-8-10(15-9)16-6-2-5-14-16;3-2(4,5)1(6)7/h2,5-8H,1,3-4H2,(H,13,15)(H,17,18);(H,6,7) |
| InChIKey | KHNGVWQHQRXYMM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|