C19H30N4O2 — CID 166237669
2-methyl-N-[3-[(piperidin-4-ylmethylcarbamoylamino)methyl]phenyl]butanamide (PubChem CID 166237669) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 2-methyl-N-[3-[(piperidin-4-ylmethylcarbamoylamino)methyl]phenyl]butanamide.
| Compound Name | 2-methyl-N-[3-[(piperidin-4-ylmethylcarbamoylamino)methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 166237669 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 2-methyl-N-[3-[(piperidin-4-ylmethylcarbamoylamino)methyl]phenyl]butanamide |
| SMILES | CCC(C)C(=O)Nc1cccc(CNC(=O)NCC2CCNCC2)c1 |
| InChI | InChI=1S/C19H30N4O2/c1-3-14(2)18(24)23-17-6-4-5-16(11-17)13-22-19(25)21-12-15-7-9-20-10-8-15/h4-6,11,14-15,20H,3,7-10,12-13H2,1-2H3,(H,23,24)(H2,21,22,25) |
| InChIKey | LDJVEWIQCUJIPM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |