C19H27N3O2 — CID 166237783
1-[oxolan-3-yl(phenyl)methyl]-3-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]urea (PubChem CID 166237783) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-[oxolan-3-yl(phenyl)methyl]-3-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]urea.
| Compound Name | 1-[oxolan-3-yl(phenyl)methyl]-3-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 166237783 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 1-[oxolan-3-yl(phenyl)methyl]-3-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]urea |
| SMILES | O=C(NCCC1=CCNCC1)NC(c1ccccc1)C1CCOC1 |
| InChI | InChI=1S/C19H27N3O2/c23-19(21-12-8-15-6-10-20-11-7-15)22-18(17-9-13-24-14-17)16-4-2-1-3-5-16/h1-6,17-18,20H,7-14H2,(H2,21,22,23) |
| InChIKey | KJLGQFQKDRGHQZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|