About 1-cyclopropyl-1-[(3,4-dimethylphenyl)methyl]-3-[(3R)-piperidin-3-yl]urea
1-cyclopropyl-1-[(3,4-dimethylphenyl)methyl]-3-[(3R)-piperidin-3-yl]urea (PubChem CID 166237828) has the molecular formula C18H27N3O
and a molecular weight of 301.43 g/mol. Its IUPAC name is 1-cyclopropyl-1-[(3,4-dimethylphenyl)methyl]-3-[(3R)-piperidin-3-yl]urea.
Molecular Properties
| Compound Name | 1-cyclopropyl-1-[(3,4-dimethylphenyl)methyl]-3-[(3R)-piperidin-3-yl]urea |
| PubChem CID | 166237828 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | 1-cyclopropyl-1-[(3,4-dimethylphenyl)methyl]-3-[(3R)-piperidin-3-yl]urea |
| SMILES | Cc1ccc(CN(C(=O)N[C@@H]2CCCNC2)C2CC2)cc1C |
| InChI | InChI=1S/C18H27N3O/c1-13-5-6-15(10-14(13)2)12-21(17-7-8-17)18(22)20-16-4-3-9-19-11-16/h5-6,10,16-17,19H,3-4,7-9,11-12H2,1-2H3,(H,20,22)/t16-/m1/s1 |
| InChIKey | FXBCHYAXIOFWSJ-MRXNPFEDSA-N |
| XLogP | 2.73 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopropyl-1-[(3,4-dimethylphenyl)methyl]-3-[(3R)-piperidin-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-1-[(3,4-dimethylphenyl)methyl]-3-[(3R)-piperidin-3-yl]urea?
The IUPAC name of 1-cyclopropyl-1-[(3,4-dimethylphenyl)methyl]-3-[(3R)-piperidin-3-yl]urea (CID 166237828) is 1-cyclopropyl-1-[(3,4-dimethylphenyl)methyl]-3-[(3R)-piperidin-3-yl]urea.
What is the SMILES notation for 1-cyclopropyl-1-[(3,4-dimethylphenyl)methyl]-3-[(3R)-piperidin-3-yl]urea?
The canonical SMILES for 1-cyclopropyl-1-[(3,4-dimethylphenyl)methyl]-3-[(3R)-piperidin-3-yl]urea is Cc1ccc(CN(C(=O)N[C@@H]2CCCNC2)C2CC2)cc1C.
What is the InChIKey of 1-cyclopropyl-1-[(3,4-dimethylphenyl)methyl]-3-[(3R)-piperidin-3-yl]urea?
The InChIKey is FXBCHYAXIOFWSJ-MRXNPFEDSA-N. The full InChI is InChI=1S/C18H27N3O/c1-13-5-6-15(10-14(13)2)12-21(17-7-8-17)18(22)20-16-4-3-9-19-11-16/h5-6,10,16-17,19H,3-4,7-9,11-12H2,1-2H3,(H,20,22)/t16-/m1/s1.
What are the key properties of 1-cyclopropyl-1-[(3,4-dimethylphenyl)methyl]-3-[(3R)-piperidin-3-yl]urea?
1-cyclopropyl-1-[(3,4-dimethylphenyl)methyl]-3-[(3R)-piperidin-3-yl]urea has a molecular weight of 301.43 g/mol, XLogP of 2.73, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-1-[(3,4-dimethylphenyl)methyl]-3-[(3R)-piperidin-3-yl]urea is sourced from PubChem (CID 166237828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).