C13H16N2O — CID 166238588
3-(2-cyclobutylpropoxy)pyridine-2-carbonitrile (PubChem CID 166238588) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-(2-cyclobutylpropoxy)pyridine-2-carbonitrile.
| Compound Name | 3-(2-cyclobutylpropoxy)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 166238588 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 3-(2-cyclobutylpropoxy)pyridine-2-carbonitrile |
| SMILES | CC(COc1cccnc1C#N)C1CCC1 |
| InChI | InChI=1S/C13H16N2O/c1-10(11-4-2-5-11)9-16-13-6-3-7-15-12(13)8-14/h3,6-7,10-11H,2,4-5,9H2,1H3 |
| InChIKey | DZOSBAZNZSUAJP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |