C11H22N2O4S — CID 166239327
2-[[cyclopropylmethyl(ethyl)sulfamoyl]-methylamino]-2-methylpropanoic acid (PubChem CID 166239327) has the molecular formula C11H22N2O4S and a molecular weight of 278.37 g/mol. Its IUPAC name is 2-[[cyclopropylmethyl(ethyl)sulfamoyl]-methylamino]-2-methylpropanoic acid.
| Compound Name | 2-[[cyclopropylmethyl(ethyl)sulfamoyl]-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 166239327 |
| Molecular Formula | C11H22N2O4S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-[[cyclopropylmethyl(ethyl)sulfamoyl]-methylamino]-2-methylpropanoic acid |
| SMILES | CCN(CC1CC1)S(=O)(=O)N(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C11H22N2O4S/c1-5-13(8-9-6-7-9)18(16,17)12(4)11(2,3)10(14)15/h9H,5-8H2,1-4H3,(H,14,15) |
| InChIKey | VPIAWMAATBHLEH-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |