C24H25F3N4O4 — CID 166239406
3-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-one;2,2,2-trifluoroacetic acid (PubChem CID 166239406) has the molecular formula C24H25F3N4O4 and a molecular weight of 490.48 g/mol. Its IUPAC name is 3-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-one;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166239406 |
| Molecular Formula | C24H25F3N4O4 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 3-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(C(=O)Cn2cnc3c(c2=O)CCNCC3)c(C)n1-c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H24N4O2.C2HF3O2/c1-15-12-19(16(2)26(15)17-6-4-3-5-7-17)21(27)13-25-14-24-20-9-11-23-10-8-18(20)22(25)28;3-2(4,5)1(6)7/h3-7,12,14,23H,8-11,13H2,1-2H3;(H,6,7) |
| InChIKey | HASPBHABZWDDHR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|