C17H17FN2O — CID 166239895
trans-(1R,2R)-2-(2-ethylphenyl)-N-(2-fluoro-3-pyridinyl)cyclopropane-1-carboxamide (PubChem CID 166239895) has the molecular formula C17H17FN2O and a molecular weight of 284.33 g/mol. Its IUPAC name is trans-(1R,2R)-2-(2-ethylphenyl)-N-(2-fluoro-3-pyridinyl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-2-(2-ethylphenyl)-N-(2-fluoro-3-pyridinyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 166239895 |
| Molecular Formula | C17H17FN2O |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | trans-(1R,2R)-2-(2-ethylphenyl)-N-(2-fluoro-3-pyridinyl)cyclopropane-1-carboxamide |
| SMILES | CCc1ccccc1[C@@H]1C[C@H]1C(=O)Nc1cccnc1F |
| InChI | InChI=1S/C17H17FN2O/c1-2-11-6-3-4-7-12(11)13-10-14(13)17(21)20-15-8-5-9-19-16(15)18/h3-9,13-14H,2,10H2,1H3,(H,20,21)/t13-,14+/m0/s1 |
| InChIKey | UAJCCULXRCVEBQ-UONOGXRCSA-N |
| XLogP | 3.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|